Isowyosine
Isowyosine is a remarkable and efficacious antiviral compound, exhibiting immense promise for the research of diverse viral afflictions, ranging from the notorious influenza to the formidable hepatitis. By virtue of its intricate mechanism of action,owyosine proficiently impedes the pernicious process of viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 577773-09-2 |
| Pricing | Inquire |
| Cas | 577773-09-2 |
| Molecular Weight | 335.32 |
| Molecular Formula | C14H17N5O5 |
| Canonical SMILES | CC1=C(N2C(=O)C3=C(N=C2N1)N(C=N3)C4C(C(C(O4)CO)O)O)C |