1-Boc-3-methylenepyrrolidine
3-Methylenepyrrolidine-1-carboxylic Acid tert-Butyl Ester, can be used as an intermediate for variety of chemical synthesis. It can be used for the preparation of aminomethylated 4-fluoropiperidines and 3-fluoropyrrolidines, which are of specific interest as bifunctional building blocks for fluorinated pharmaceutical compds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB003324 |
| Pricing | Inquire |
| Cas | 114214-71-0 |
| Molecular Weight | 183.25 |
| Molecular Formula | C10H17NO2 |
| Canonical SMILES | CC(C)(C)OC(=O)N1CCC(=C)C1 |