UNA-U-CE Phosphoramidite
UNA-U-CE Phosphoramidite is a compound utilized in nucleic acid synthesis, particularly in RNA synthesis. It consists of UNA (Unlocked Nucleic Acid), denoted by "UNA," which modifies the nucleotide structure and properties. The "U" signifies uridine as the base, and "CE" indicates cyanoethyl, a protecting group for the phosphate moiety. "Phosphoramidite" refers to the reactive form of the nucleotide used in automated oligonucleotide synthesis. This compound enables controlled addition of modified uridine nucleotides during RNA synthesis for various research and biotechnological applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00432 |
| Pricing | Inquire |
| Cas | 1120329-48-7 |
| Molecular Weight | 852.91 |
| Molecular Formula | C46H53N4O10P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)OC(COC(=O)C4=CC=CC=C4)N5C=CC(=O)NC5=O |