Desmethyl Erlotinib-[d4]
Desmethyl Erlotinib-[d4], is an isotope labelled derivative of Desmethyl Erlotinib, which is a metabolite of Erlotinib. Erlotinib is a medication used to treat non-small cell lung cancer and pancreatic cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003688 |
| Pricing | Inquire |
| Cas | 1216420-11-9 |
| Molecular Weight | 383.44 |
| Molecular Formula | C21H17D4N3O4 |
| Canonical SMILES | COCCOC1=C(C=C2C(=C1)N=CN=C2NC3=CC=CC(=C3)C#C)OCCO |