MS351
MS351 is an antagonist of chromobox 7 (CBX7) that acts by binding the CBX7 chromodomain (CBX7ChD). It inhibits H3K27me3 binding to promote the binding of long noncoding RNA to the CBX7ChD. It effectively induces transcriptional derepression of CBX7 target genes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 472984-79-5 |
| Pricing | Inquire |
| Cas | 472984-79-5 |
| Molecular Weight | 462.8 |
| Molecular Formula | C23H21Cl2N3O·HCl |
| Canonical SMILES | CC1=CC=CC=C1CN2C3=CC=CC=C3N(C2=N)CC(C4=CC(=C(C=C4)Cl)Cl)O.Cl |