5'-O-(Dimethoxytrityl)-5-[N-(2-(trifluoroacetamido)ethyl)-3-(E)acrylamido]-2'-deoxyuridine
5'-O-(Dimethoxytrityl)-5-[N-(2-(trifluoroacetamido)ethyl)-3-(E)acrylamido]-2'-deoxyuridine is a crucial compound in biomedicine used for the development of antiviral drugs. With its unique chemical structure, it exhibits activity against a variety of viral infections, including DNA viruses, RNA viruses, and retroviruses. This product plays a pivotal role in the synthesis of potent antiviral medication, contributing to the treatment and prevention of numerous viral diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 153512-23-3 |
| Pricing | Inquire |
| Cas | 153512-23-3 |
| Molecular Weight | 738.73 |
| Molecular Formula | C37H37F3N4O9 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=C(C(=O)NC5=O)C=CC(=O)NCCNC(=O)C(F)(F)F)O |