ML241
ML241 is a selective p97 ATPase inhibitor and IC50 value is 100 nM. It can inhibit degradation of a p97-dependent but not a p97-independent proteasome substrate in a dual-reporter cell line. ML241 may be a novel agent for the treatment of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-475332 |
| Pricing | Inquire |
| Cas | 1346528-06-0 |
| Molecular Weight | 372.46 |
| Molecular Formula | C23H24N4O |
| Canonical SMILES | C1(N2CCOC3=CC=CC=C23)=NC(NCC4=CC=CC=C4)=C5CCCCC5=N1 |