2, 3, 6, 8- Tetrahydroxybenzofuro[3, 2- b] [1] benzopyran- 5- ium Chloride
2,?3,?6,?8-?Tetrahydroxybenzofuro[3,?2-?b]?[1]?benzopyran-?5-?ium Chloride can be used in the synthesis of Riccionidin A (CAS# 155518-34-6), which is a flavonoid, whose biosynthesis is regulated by R2R3-MYB transcription factors in Marchantia polymorpha.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB057451 |
| Pricing | Inquire |
| Cas | 207743-58-6 |
| Molecular Weight | 285.23 + 35.45 |
| Molecular Formula | C15H9O6⁺·Cl ⁻ |
| Canonical SMILES | C1=C2C=C3C(=C4C(=CC(=CC4=[OH+])O)O3)OC2=CC(=C1O)O.[Cl-] |