L-Aspartic acid β-tert-butyl ester
L-Aspartic acid 4-tert-butyl ester is a protected form of L-Aspartic acid. L-Aspartic acid is a non-essential amino acid that is used to biosynthesize other amino acids within the human body. L-Aspartic acid also increases membrane conductance of mammalian neurons by voltage-dependent means, causing depolarization and nerve impulses that travel to key areas of the central nervous system.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-004122 |
| Pricing | Inquire |
| Cas | 3057-74-7 |
| Molecular Weight | 189.20 |
| Molecular Formula | C8H15NO4 |
| Canonical SMILES | CC(C)(C)OC(=O)CC(C(=O)O)N |