(4S,6R,7S,10R,11E)-4,5,6,7,8,9-Hexahydro-4-acetoxy-3-(acetoxymethyl)-7,10-epoxy-6,7-dihydroxy-6,10-dimethylcyclodeca[b]furan-2(10H)-one
(4S,6R,7S,10R,11E)-4,5,6,7,8,9-Hexahydro-4-acetoxy-3-(acetoxymethyl)-7,10-epoxy-6,7-dihydroxy-6,10-dimethylcyclodeca[b]furan-2(10H)-one is a natural compound of immense interest in the domain of natural compound, possessing exceptional prospects for studying a wide array of ailments, encompassing cancer, inflammation and microbial infections, which underscores its potential as a groundbreaking pharmacological agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5675 |
| Pricing | Inquire |
| Cas | 101628-29-9 |
| Molecular Weight | 396.392 |
| Molecular Formula | C19H24O9 |
| Canonical SMILES | CC(=O)OCC1=C2C(CC(C3(CCC(O3)(C=C2OC1=O)C)O)(C)O)OC(=O)C |