Uridylyl-2'-5'-uridine ammonium salt
Uridylyl-2'-5'-uridine ammonium salt is an indispensable and pivotal biomolecule within the biomedical sector, involved in the intricate orchestration of RNA sequence synthesis and modification. Its indispensable functionality encompasses the research of cellular wholeness and the orchestration of gene expression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 108321-54-6 |
| Pricing | Inquire |
| Cas | 108321-54-6 |
| Molecular Weight | 567.41 |
| Molecular Formula | C18H23N4O14P·NH3 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OC3C(C(OC3N4C=CC(=O)NC4=O)CO)O)O)O.N |