Evernic Acid
Evernic acid is a secondary metabolite produced by some species of lichen. It is an inhibitor of two key plasmodial FAS-II enzymes PfFabZ and PfFabI (IC50 = 10.7 and 36.1 µM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 537-09-7 |
| Pricing | Inquire |
| Cas | 537-09-7 |
| Molecular Weight | 332.3 |
| Molecular Formula | C17H16O7 |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)OC2=CC(=C(C(=C2)C)C(=O)O)O)O)OC |