FDI 6
FDI 6 is an inhibitor of the Forkhead box protein M1 transcription factor (FOXM1) (IC50 value 22.5 µM) that suppresses FOXM1 binding to DNA. FDI6 displaces FOXM1 from genomic targets in MCF-7 breast cancer cells, and downregulates concomitant transcription.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-054874 |
| Pricing | Inquire |
| Cas | 313380-27-7 |
| Molecular Weight | 437.43 |
| Molecular Formula | C19H11F4N3OS2 |
| Canonical SMILES | C1=CSC(=C1)C2=NC3=C(C(=C2)C(F)(F)F)C(=C(S3)C(=O)NC4=CC=C(C=C4)F)N |