Cangrelor-[13C,d7]
Cangrelor-[13C,d7], is the labelled analogue of Cangrelor. Cangrelor, an adenylic acid derivative, has been found to be a P2Y12 inhibitor that could be effective in some coronary artery diseases. It is approved by FDA as an antiplatelet drug. It has been used to reduce the risk of heart attack during cardiology procedures.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002138 |
| Pricing | Inquire |
| Molecular Weight | 784.4 |
| Molecular Formula | C16[13C]H18D7Cl2F3N5O12P3S2 |
| Canonical SMILES | CSCCNC1=C2C(=NC(=N1)SCCC(F)(F)F)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(C(P(=O)(O)O)(Cl)Cl)O)O)O |