1-Methyl-4-nitro-1H-Imidazole-2-carboxylic Acid
1-Methyl-4-nitro-1H-Imidazole-2-carboxylic Acid is an intermediate used in the synthesis of imidazole-containing DNA minor groove binding oligopeptides related to the antiviral antibiotic netropsin. It is also used to prepare distamycin derivatives with antitumor activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB059486 |
| Pricing | Inquire |
| Cas | 109012-24-0 |
| Molecular Weight | 171.11 |
| Molecular Formula | C5H5N3O4 |
| Canonical SMILES | CN1C=C(N=C1C(=O)O)[N+](=O)[O-] |