AST 487
AST487 is a Ret kinase inhibitor/FLT3 inhibitor, which displays high selectivity and potency toward FLT3 as a molecular target, and which could potentially be used to override drug resistance in AML. It induced a dose-dependent growth inhibition of xenografts of NIH3T3 cells expressing oncogenic RET, and of the MTC cell line TT in nude mice.It also inhibited calcitonin gene expression in vitro in TT cells, in part, through decreased gene transcription.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-463295 |
| Pricing | Inquire |
| Cas | 630124-46-8 |
| Molecular Weight | 529.56 |
| Molecular Formula | C26H30F3N7O2 |
| Canonical SMILES | CCN1CCN(CC1)CC2=C(C=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC4=NC=NC(=C4)NC)C(F)(F)F |