2'-Deoxy-8-methoxyadenosine
2'-Deoxy-8-methoxyadenosine, a renowned compound in the field of biomedicine, emerges as a substantial candidate for combating specific ailments. Its applicability extends to the synthesis of antiviral medications, exhibiting efficacy against formidable viruses like hepatitis C and HIV. Moreover, this compound displays encouraging results in addressing diverse viral infections, thereby establishing itself as a formidable weapon against the relentless battle of infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17318-17-1 |
| Pricing | Inquire |
| Cas | 17318-17-1 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | COC1=NC2=C(N=CN=C2N1C3CC(C(O3)CO)O)N |