(2-(Phenoxycarbonyl)phenyl)boronic acid
(2-(Phenoxycarbonyl)phenyl)boronic acid is a boronic acid catalyst from the Hall Group developed for chemoselective activation of oxime N−OH bonds for the preparation of functionalized amide compounds via Beckmann Rearrangement. This catalyst is efficient to transform various diaryl, aryl-alkyl, heteroaryl-alkyl, and dialkyl oximes to amide products under ambient conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2211934-51-7 |
| Pricing | Inquire |
| Cas | 2211934-51-7 |
| Molecular Weight | 242.04 |
| Molecular Formula | C13H11BO4 |
| Canonical SMILES | B(C1=CC=CC=C1C(=O)OC2=CC=CC=C2)(O)O |