Methdilazine-[d4] Hydrochloride
Methdilazine-[d4] Hydrochloride is the labelled analogue of Methdilazine Hydrochloride. Methdilazine Hydrochloride is a Histamine H1 receptor antagonist with anticholinergic properties and can be used for the treatment of hypersensitivity reactions and pruritic skin disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004698 |
| Pricing | Inquire |
| Cas | 1330055-82-7 |
| Molecular Weight | 336.92 |
| Molecular Formula | C18H16D4N2S.HCl |
| Canonical SMILES | CN1CCC(C1)CN2C3=CC=CC=C3SC4=CC=CC=C42.Cl |