Suc-Leu-Tyr-AMC
| Supplier | Creative Peptides |
|---|---|
| Product # | R0810 |
| CAS # | 94367-20-1 |
| Pricing | Inquire |
| BoilingPoint | 945.5ºC at 760mmHg |
| Synonyms | Suc-LY-AMC |
| MolecularFormula | C₂₉H₃₃N₃O₈ |
| MolecularWeight | 551.6 |
| Source | Synthetic |
| Sequence | Suc-LY-AMC |
| Storage | -20°C |
| Explanation | Suc-Leu-Tyr-AMC is a fluorescent substrate for calpain I and II and papain (another cysteine protease), and used for measuring the chymotrypsin-like peptidase activity of the 20S proteasome (excitation max: 360 nm; emission max: 460 nm). Suc-Leu-Tyr-AMC can also be cleaved by the Ti protease from E. coli. |
| Application | A fluorgenic substrate |
| InChI | InChI=1S/C29H33N3O8/c1-16(2)12-22(31-25(34)10-11-26(35)36)29(39)32-23(14-18-4-7-20(33)8-5-18)28(38)30-19-6-9-21-17(3)13-27(37)40-24(21)15-19/h4-9,13,15-16,22-23,33H,10-12,14H2,1-3H3,(H,30,38)(H,31,34)(H,32,39)(H,35,36)/t22-,23-/m0/s1 |
| InChIKey | RIYLNECMTVNMSO-GOTSBHOMSA-N |
| Solubility | Soluble in DMSO |
| IsomericSMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CC=C(C=C3)O)NC(=O)[C@H](CC(C)C)NC(=O)CCC(=O)O |
| Appearance | White to off-white powder |
| Purity | >98% |
| AreasOfInterest | Cell Biology |