Carboxy-PEG2-sulfonic acid
Carboxy-PEG2-sulfonic acid is a PEG linker containing a carboxylic acid and a sulfonic acid end group. The terminal carboxylic acid can participate in reactions with primary amines in the presence of activators such as EDC and HATU. Sulfonic acid can undergo esterification, halogenation and replacement reactions. The hydrophilic PEG linker increases the compound's water solubility in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-500547 |
| Pricing | Inquire |
| Cas | 1817735-45-7 |
| Molecular Weight | 242.24 |
| Molecular Formula | C7H14O7S |
| Canonical SMILES | C(COCCOCCS(=O)(=O)O)C(=O)O |