N2-(1,1,4,4-Tetramethyldisilylazacyclopentanyl)-O6-benzyl-8-bromo-N9-[3',5'-O-(1,1,3,3-tetrakis(isopropyl)-1,3-disiloxanediyl)-β-D-2'-deoxyribofuranosyl]guanine
N2-(1,1,4,4-Tetramethyldisilylazacyclopentanyl)-O6-benzyl-8-bromo-N9-[3',5'-O-(1,1,3,3-tetrakis(isopropyl)-1,3-disiloxanediyl)-β-D-2'-deoxyribofuranosyl]guanine is a vital product used in the biomedical industry. This compound demonstrates potential in treating various diseases, including certain viral infections. It acts as a potent antiviral agent, specifically targeting the replication of viral genomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 328394-28-1 |
| Pricing | Inquire |
| Cas | 328394-28-1 |
| Molecular Weight | 821.11 |
| Molecular Formula | C35H58BrN5O5Si4 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(CC(O2)N3C4=C(C(=NC(=N4)N5[Si](CC[Si]5(C)C)(C)C)OCC6=CC=CC=C6)N=C3Br)O[Si](O1)(C(C)C)C(C)C)C(C)C |