HC Toxin
HC Toxin is a cell-permeable histone deacetylase (HDAC) inhibitor (IC50 = 30 nM) that inhibits HDACs in maize, Physarum and chicken. HC Toxin is metabolized from H. carbonum (now C. carbonum), and displays antifungal and antiproliferative effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83209-65-8 |
| Pricing | Inquire |
| Cas | 83209-65-8 |
| Molecular Weight | 436.50 |
| Molecular Formula | C21H32N4O6 |
| Canonical SMILES | CC1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N1)C)CCCCCC(=O)C3CO3 |