5'-O-(Dimethoxytrityl)-8-Oxo-N2-isobutyryl-2'-deoxyguanosine
5'-O-(Dimethoxytrityl)-8-Oxo-N2-isobutyryl-2'-deoxyguanosine is an intricately designed and highly innovative derivative of 2'-deoxyguanosine, showcasing exceptional effectiveness in eradicating drug-resistant strains, rendering it an esteemed contender in the battle against notorious viral afflictions and malignant neoplasms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 136859-77-3 |
| Pricing | Inquire |
| Cas | 136859-77-3 |
| Molecular Weight | 655.71 |
| Molecular Formula | C35H37N5O8 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)NC(=O)N2C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |