Chloroorienticin B
Chloroorienticin B is produced by the strain of Amycolatopsis orientalis (Nocardia orientalis) PA-45052. Each component of Chloroorienticin had anti-Staphylococcus aureus and methicillin-resistant Staphylococcus aureus (MRSA) activity, and the activity was stronger than that of orientalis and vancomycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00311 |
| Pricing | Inquire |
| Cas | 118373-81-2 |
| Molecular Weight | 1449.25 |
| Molecular Formula | C66H75Cl2N9O24 |
| Canonical SMILES | CC1C(C(CC(O1)OC2C3C(=O)NC(C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)C(C(=O)N3)NC(=O)C6C7=CC(=C(C(=C7)OC8=C(C=C2C=C8)Cl)OC9C(C(C(C(O9)CO)O)O)O)OC1=C(C=C(C=C1)C(C(C(=O)NC(C(=O)N6)CC(=O)N)NC(=O)C(CC(C)C)NC)O)Cl)O)C(=O)O)(C)N)O |