2-Acetamido-2-deoxy-3-O-methyl-D-glucopyranose
2-Acetamido-2-deoxy-3-O-methyl-D-glucopyranose is commonly known as N-acetylglucosamine mainly functioning in involving combatting bacterial infections, specifically those instigated by gram-positive bacteria. Furthermore, it fosters the formulation of therapeutic remedies to tackle ailments such as cancer and metabolic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 94825-74-8 |
| Pricing | Inquire |
| Cas | 94825-74-8 |
| Molecular Weight | 235.23 |
| Molecular Formula | C9H17NO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1O)CO)O)OC |