Norastemizole Hydrobromide
Norastemizole Hydrobromide is a potent and selective H1 receptor antagonist used as an antihistamine for the treatment of allergic rhinitis and asthma which does not induce adverse effects such as cardiac arrhythmia, fatigue, or general body weakness.
| Supplier | BOC Sciences |
|---|---|
| Product # | 75970-64-8 |
| Pricing | Inquire |
| Cas | 75970-64-8 |
| Molecular Weight | 486.22 |
| Molecular Formula | C19H23Br2FN4 |
| Canonical SMILES | C1CNCCC1NC2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F.Br.Br |