3'-O-TBDMS-2'-O-Me-rG(iBu)
Guanosine, 3'-O-[(1,1-dimethylethyl)dimethylsilyl]-2'-O-methyl-N-(2-methyl-1-oxopropyl) - the nucleoside analog believed to hold great potential in the fight against a wide range of viral infections and certain cancers. Extensively researched for its ability to disrupt viral or cancerous DNA replication, Guanosine, 3'-O-[(1,1-dimethylethyl)dimethylsilyl]-2'-O-methyl-N-(2-methyl-1-oxopropyl) has been shown to be effective against HCV, HIV, herpes simplex virus, leukemia and lung cancer - making it a powerful tool in the battle against these debilitating diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 863097-97-6 |
| Pricing | Inquire |
| Cas | 863097-97-6 |
| Molecular Weight | 481.62 |
| Molecular Formula | C21H35N5O6Si |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)CO)O[Si](C)(C)C(C)(C)C)OC |