4-Ethynylphenylboronic acid pinacol ester
4-Ethynylphenylboronic acid pinacol ester can be used:• For the functionalization of platinum nanoparticles to leverage their photoluminescence properties.• As an intermediate in the synthesis of covalent heterodyads of chlorophyll derivatives applicable as supramolecular light-harvesting systems.• As an intermediate in the preparation of F-18 radiolabeled galectin-3 inhibitors, which are used as surrogate positron emission tomography (PET) tracers of TD139 and GB1107.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1034287-04-1 |
| Pricing | Inquire |
| Cas | 1034287-04-1 |
| Molecular Weight | 228.09 |
| Molecular Formula | C14H17BO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#C |