Aspergillumarin B
Aspergillumarins B is a dihydroisocoumarin derivative isolated from the culture broth of a marine-derived fungus Aspergillus sp., which was isolated from the fresh leaf of the mangrove tree Bruguiera gymnorrhiza collected from the South China Sea. Aspergillumarins B showed weak antibacterial activity against Staphylococcus aureus and Bacillus subtilis at a concentration of 50 μg/mL.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1392495-07-6 |
| Pricing | Inquire |
| Cas | 1392495-07-6 |
| Molecular Weight | 250.29 |
| Molecular Formula | C14H18O4 |
| Canonical SMILES | CC(CCCC1CC2=C(C(=CC=C2)O)C(=O)O1)O |