ESI 05
ESI-05 is an Epac2 inhibitor that inhibits cAMP binding to EPAC2 and cAMP mediated EPAC2 guanine nucleotide exchange factor (GEF) activity (IC50 = 0.4 μM). It is selective for Epac2 over Epac1 and PKA at 25 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5184-64-5 |
| Pricing | Inquire |
| Cas | 5184-64-5 |
| Molecular Weight | 274.38 |
| Molecular Formula | C16H18O2S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=C(C=C(C=C2C)C)C |