1-(2,3-Dimethylphenyl)-1-(1-trityl-1H-imidazol-4-yl)ethan-1-ol
1-(2,3-Dimethylphenyl)-1-(1-trityl-1H-imidazol-4-yl)ethan-1-ol is a formidable biomedical compound, displaying profound implications in the research of a multitude of ailments, most notably cancer. Encapsulating paramount significance, this remarkable product effectively thwarts the proliferation of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 176721-03-2 |
| Pricing | Inquire |
| Cas | 176721-03-2 |
| Molecular Weight | 458.59 |
| Molecular Formula | C32H30N2O |
| Canonical SMILES | CC1=C(C(=CC=C1)C(C)(C2=CN=CN2C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)O)C |