R 428 dihydrochloride
R 428 dihydrochloride is a potent and selective inhibitor of Axl receptor tyrosine kinases (IC50 = 14 nM). R428 inhibits Axl kinase and Axl-dependent events, including Akt phosphorylation, breast cancer cell invasion, and proinflammatory cytokine production.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2108833-51-6 |
| Pricing | Inquire |
| Cas | 2108833-51-6 |
| Molecular Weight | 579.57 |
| Molecular Formula | C30H34N8.2HCl |
| Canonical SMILES | C1CCN(C1)C2CCC3=C(CC2)C=C(C=C3)NC4=NN(C(=N4)N)C5=NN=C6C(=C5)CCCC7=CC=CC=C76.Cl.Cl |