Ensartinib dihydrochloride
Ensartinib is a potent new-generation ALK inhibitor with high activity against a broad range of known crizotinib-resistant ALK mutations and CNS metastases. Ensartinib has the potential for the treatment of crizotinib-resistant, ALK-positive non-small-cell lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2137030-98-7 |
| Pricing | Inquire |
| Cas | 2137030-98-7 |
| Molecular Weight | 634.36 |
| Molecular Formula | C26H29Cl4FN6O3 |
| Canonical SMILES | CC1CN(CC(N1)C)C(=O)C2=CC=C(C=C2)NC(=O)C3=NN=C(C(=C3)OC(C)C4=C(C=CC(=C4Cl)F)Cl)N.Cl.Cl |