6-Chloro-2-bromo-9-(2,3,5-tri-O-acetyl)-beta-D-ribofuranosyl-9H-purine
6-Chloro-2-bromo-9-(2,3,5-tri-O-acetyl)-beta-D-ribofuranosyl-9H-purine is a highly efficacious biomedical compound with exceptional antiviral attributes rendering it especially indispensable in research of combatting purine-sensitive viral infections. By repressing viral replication, it not only hampers the proliferation of such pathogens but also diminishes the intensity of concomitant symptoms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40896-58-0 |
| Pricing | Inquire |
| Cas | 40896-58-0 |
| Molecular Weight | 491.68 |
| Molecular Formula | C16H16BrClN4O7 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C2N=C(N=C3Cl)Br)OC(=O)C)OC(=O)C |