7-Hydroxy coumarin 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester
7-Hydroxy coumarin 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester is a fascinating and multifunctional compound, embodying the concept of a procompound which undergoes enzymatic hydrolysis within living organisms and ultimately liberates the remarkable 7-Hydroxy coumarin.
| Supplier | BOC Sciences |
|---|---|
| Product # | 168286-97-3 |
| Pricing | Inquire |
| Cas | 168286-97-3 |
| Molecular Weight | 478.40 |
| Molecular Formula | C22H22O12 |
| Canonical SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC2=CC3=C(C=C2)C=CC(=O)O3)C(=O)OC)OC(=O)C |