TCS 2510
TCS 2510 is a selective EP4 agonist (EC50 = 2.5 nM; Ki = 1.2 nM) that displays no significant binding at other prostaglandin receptors at concentrations up to 14 μM. EP4 agonist improves bone healing, provides cardio- and neuroprotection, and reduces inflammation and renal dysfunction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 346673-06-1 |
| Pricing | Inquire |
| Cas | 346673-06-1 |
| Molecular Weight | 383.49 |
| Molecular Formula | C21H29N5O2 |
| Canonical SMILES | C1CC(=O)N(C1C=CC(CC2=CC=CC=C2)O)CCCCCCC3=NNN=N3 |