Dronedarone-[13C,d3]
Dronedarone-[13C,d3] is a labelled analogue of Dronedarone. Dronedarone is a Class III antiarrhythmic and a multi-channel blocker for atrial fibrillation. It blocks potassium, sodium, and calcium channels and also exhibits antiadrenergic properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005250 |
| Pricing | Inquire |
| Cas | 1261398-74-6 |
| Molecular Weight | 560.77 |
| Molecular Formula | C30[13C]H41D3N2O5S |
| Canonical SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)NS(=O)(=O)C)C(=O)C3=CC=C(C=C3)OCCCN(CCCC)CCCC |