5-[(2-Hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
5-[(2-Hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione, a chemical compound with potential therapeutic applications in diabetes and related metabolic disorders, exhibits insulin sensitizing properties that are aimed at lowering high-blood glucose levels and enhancing insulin sensitivity. Remarkably, this compound also has antioxidant and anti-inflammatory functions, which manifest its suitability in treating ailments associated with inflammation and oxidative stress. Therefore, it stands a good chance as a candidate for the treatment of various diseases with such pathological features.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0001-284762 |
| Pricing | Inquire |
| Cas | 6325-94-6 |
| Molecular Weight | 221.23 |
| Molecular Formula | C10H7NO3S |
| Canonical SMILES | C1=CC=C(C(=C1)C=C2C(=O)NC(=O)S2)O |