2,3,6,2',3',4',6'-Hexa-O-acetyl-D-cellobial
2,3,6,2',3',4',6'-Hexa-O-acetyl-D-cellobial, a remarkable biomedical innovation, presents an exceedingly intricate and sophisticated composition. As a ground-breaking chemotherapeutic agent, it showcases its exceptional antitumor attributes, deftly obstructing the exponential growth of malignant cells whilst triggering programmed cell death.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67314-36-7 |
| Pricing | Inquire |
| Cas | 67314-36-7 |
| Molecular Weight | 560.51 |
| Molecular Formula | C24H32O15 |
| Canonical SMILES | CC(=O)OCC1C(C(C=CO1)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |