Fluorescein-12-UTP
Fluorescein-12-UTP is a vital tool used in biomedical field for the detection and imaging of RNA molecules. This fluorescent nucleotide analog incorporates into RNA during transcription is allowing for the visualization and tracking of RNA synthesand localization. With its distinct fluorescence, Fluorescein-12-UTP is valuable for research in molecular biology, gene expression analysis and the study of RNA-based diseases like cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 185843-23-6 |
| Pricing | Inquire |
| Cas | 185843-23-6 |
| Molecular Weight | 1010.68 |
| Molecular Formula | C39H41N4O22P3 |
| Canonical SMILES | O=C1OC2(C3=CC=C(O)C=C3OC4=CC(O)=CC=C42)C5=CC=C(C=C15)C(=O)NCCCCCC(=O)NCC=CC6=CN(C(=O)NC6=O)C7OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C7O |