Debrisoquin hydriodide
Debrisoquin is an adrenergic neuron-blocking drug similar in effects to guanethidine. It is an antihypertensive drug with antioxidant, anti-inflammatory, and neuroprotective properties. It can regulate the activity of certain neurotransmitters, including dopamine and serotonin, which makes it a promising candidate for treating neurological disorders, such as Parkinson's disease and depression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1052540-65-4 |
| Pricing | Inquire |
| Cas | 1052540-65-4 |
| Molecular Weight | 303.14 |
| Molecular Formula | C10H13N3.HI |
| Canonical SMILES | C1CN(CC2=CC=CC=C21)C(=N)N.I |