2'-Deoxy-N7-methylguanosine
2'-Deoxy-N7-methylguanosine is a molecule that plays a vital role in biomedical research. It is often used as a substrate in enzymatic assays to study DNA replication and repair processes. Additionally, it has been found to have potential applications in cancer therapies, as it can target and inhibit telomerase, an enzyme commonly upregulated in cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26718-69-4 |
| Pricing | Inquire |
| Cas | 26718-69-4 |
| Molecular Weight | 283.28 |
| Molecular Formula | C11H17N5O4 |
| Canonical SMILES | CN1CN(C2=C1C(=O)NC(=N2)N)C3CC(C(O3)CO)O |