Ezatiostat hydroChloride
Ezatiostat hydrochloride is the hydrochloride salt form of Ezatiostat. Ezatiostat, also called as Telintra or TER 199, is a liposomal small-molecule glutathione analog inhibitor of glutathione S-transferase (GST) P1-1 with hematopoiesis-stimulating activi
| Supplier | BOC Sciences |
|---|---|
| Product # | 286942-97-0 |
| Pricing | Inquire |
| Cas | 286942-97-0 |
| Molecular Weight | 566.11 |
| Molecular Formula | C27H35N3O6S.HCl |
| Canonical SMILES | CCOC(=O)C(CCC(=O)NC(CSCC1=CC=CC=C1)C(=O)NC(C2=CC=CC=C2)C(=O)OCC)N.Cl |