Amiprofos-methyl
Amiprofos-methyl (APM) is a phosphoric amide herbicide that prevents microtubule polymerization in plant cells, but not animal cells, which is used as antimicrotubule herbicide for the production of doubled haploid plants from anther-derived maize callus. APM inhibits calcium accumulation in corn mitochondria with IC50 of 140 nM and induces a 3-fold increase in the rate of calcium efflux from rat liver mitochondria at a concentration of 100 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36001-88-4 |
| Pricing | Inquire |
| Cas | 36001-88-4 |
| Molecular Weight | 304.3 |
| Molecular Formula | C11H17N2O4PS |
| Canonical SMILES | COP(=S)(NC(C)C)Oc1ccc(C)cc1[N+](=O)[O-] |