Amoxicillin (3-Ethoxy-1-methyl-3-oxo-1-propenyl)amino Diethylethanamine
Amoxicillin (3-Ethoxy-1-methyl-3-oxo-1-propenyl)amino Diethylethanamine is an intermediate in the synthesis of Amoxicillin, which is an antibiotic used to treat a number of bacterial infections including middle ear infections, strep throat, pneumonia, skin infections, and urinary tract infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65959-31-1 |
| Pricing | Inquire |
| Cas | 65959-31-1 |
| Molecular Weight | 578.72 |
| Molecular Formula | C22H27N3O7S.C6H15N |
| Canonical SMILES | O=C(OCC)C=C(NC(C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O)C3=CC=C(O)C=C3)C.N(CC)(CC)CC |