SB 224289
SB 224289 is a selective 5-HT1B receptor antagonist (pKi = 8.2) displaying >60-fold selectivity over 5-HT1D, 5-HT1A, 5-HT1E, 5-HT1F, 5-HT2A and 5-HT2C receptors in radioligand binding and functional assays. SB 224289 exhibits anxiolytic activity.
Supplier | BOC Sciences |
---|---|
Product # | 180083-23-2 |
Pricing | Inquire |
Cas | 180083-23-2 |
Molecular Weight | 520.62 |
Molecular Formula | C32H32N4O3 |
Canonical SMILES | CC1=C(C=CC(=C1)C2=NOC(=N2)C)C3=CC=C(C=C3)C(=O)N4CCC5=CC6=C(C=C54)C7(CCN(CC7)C)CO6 |