(5'S)-8,5'-Cycloadenosine
(5'S)-8,5'-Cycloadenosine is a highly specialized compound utilized in the field of biomedicine. It plays a crucial role in the treatment of various diseases such as cancer, cardiovascular disorders, and neurodegenerative conditions. This compound acts as an adenosine receptor agonist, exhibiting significant therapeutic potential in managing these ailments. Extensive research has demonstrated its ability to modulate cellular signaling pathways, making it a promising candidate for future drug development within the biomedical industry.
| Supplier | BOC Sciences |
|---|---|
| Product # | 41432-67-1 |
| Pricing | Inquire |
| Cas | 41432-67-1 |
| Molecular Weight | 265.23 |
| Molecular Formula | C10H11N5O4 |
| Canonical SMILES | C1=NC(=C2C(=N1)N3C4C(C(C(O4)C(C3=N2)O)O)O)N |