Galacto-PUGNAc
Galacto-PUGNAc is a synthetic compound widely employed in the biomedical sector, standing as a renowned potent inhibitor. Its primary application centers around investigating the intricate involvement of O-GlcNAcase (OGA) in diseases encompassing cancer and diabetes. This remarkable chemical compound selectively targets and inhibits the activity of OGA, thereby impeding the elimination of N-acetylglucosamine (GlcNAc) from protein residues.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1145878-98-3 |
| Pricing | Inquire |
| Cas | 1145878-98-3 |
| Molecular Weight | 353.33 |
| Molecular Formula | C15H19N3O7 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1=NOC(=O)NC2=CC=CC=C2)CO)O)O |