Pravadoline
Pravadoline is a COX inhibitor and cannabinoid CB agonist used as an anti-inflammatory and analgesic agent. It inhibits prostaglandin synthesis, and it also suppresses neuronally stimulated contractions in mouse model, which differs from NSAIDs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 92623-83-1 |
| Pricing | Inquire |
| Cas | 92623-83-1 |
| Molecular Weight | 378.46 |
| Molecular Formula | C23H26N2O3 |
| Canonical SMILES | CC1=C(C2=CC=CC=C2N1CCN3CCOCC3)C(=O)C4=CC=C(C=C4)OC |